* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JALOR-CHEM I14-12673 |
English Synonyms: | JALOR-CHEM I14-12673 |
MDL Number.: | MFCD22422717 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(c1cc(cc(c1)Cl)F)N2C3CCC2CC4(C3)CO4 |
InChi: | InChI=1S/C16H19ClFNO/c1-10(11-4-12(17)6-13(18)5-11)19-14-2-3-15(19)8-16(7-14)9-20-16/h4-6,10,14-15H,2-3,7-9H2,1H3 |
InChiKey: | InChIKey=BTEHKAKCKMPGGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.