Molecular Structure:
CCD No.:CCD07401121
JALOR-CHEM I14-12679
Formula:C17 H20 N2 O
MolWeight:268.358
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | JALOR-CHEM I14-12679 |
| English Synonyms： | JALOR-CHEM I14-12679 |
| MDL Number.： | MFCD22422721 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | CC(c1cccc(c1)C#N)N2C3CCC2CC4(C3)CO4 |
| InChi： | InChI=1S/C17H20N2O/c1-12(14-4-2-3-13(7-14)10-18)19-15-5-6-16(19)9-17(8-15)11-20-17/h2-4,7,12,15-16H,5-6,8-9,11H2,1H3 |
| InChiKey： | InChIKey=IRFNAZZMWCLPND-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
