Molecular Structure:
CCD No.:CCD07401122
JALOR-CHEM I14-12681
Formula:C16 H22 N2 O
MolWeight:258.363
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | JALOR-CHEM I14-12681 |
| English Synonyms： | JALOR-CHEM I14-12681 |
| MDL Number.： | MFCD22422723 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | Cc1cccc(n1)C(C)N2C3CCC2CC4(C3)CO4 |
| InChi： | InChI=1S/C16H22N2O/c1-11-4-3-5-15(17-11)12(2)18-13-6-7-14(18)9-16(8-13)10-19-16/h3-5,12-14H,6-10H2,1-2H3 |
| InChiKey： | InChIKey=PHOSEGBLLOEKEK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
