* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JALOR-CHEM I14-12724 |
English Synonyms: | JALOR-CHEM I14-12724 |
MDL Number.: | MFCD22422729 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cncc2c1c3c([nH]2)c(=O)[nH]cn3 |
InChi: | InChI=1S/C9H6N4O/c14-9-8-7(11-4-12-9)5-1-2-10-3-6(5)13-8/h1-4,13H,(H,11,12,14) |
InChiKey: | InChIKey=BFZSTMJNOYTZQE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.