* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JALOR-CHEM I14-15428 |
English Synonyms: | JALOR-CHEM I14-15428 |
MDL Number.: | MFCD22422820 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)(C)NC(=O)[C@]1(C[C@H]1C=C)C(=O)NS(=O)(=O)C2CC2 |
InChi: | InChI=1S/C14H22N2O4S/c1-5-9-8-14(9,11(17)15-13(2,3)4)12(18)16-21(19,20)10-6-7-10/h5,9-10H,1,6-8H2,2-4H3,(H,15,17)(H,16,18)/t9-,14-/m1/s1 |
InChiKey: | InChIKey=QPYQUXRUIACAJA-YMTOWFKASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.