* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GRIFFITHINAM |
CAS: | 240122-32-1 |
English Synonyms: | GRIFFITHINAM |
MDL Number.: | MFCD22479207 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COc1cccc2c1cc3c4c2c(c(cc4C(=O)N3)OC)O |
InChi: | InChI=1S/C17H13NO4/c1-21-12-5-3-4-8-9(12)6-11-14-10(17(20)18-11)7-13(22-2)16(19)15(8)14/h3-7,19H,1-2H3,(H,18,20) |
InChiKey: | InChIKey=QKAHURDEAZTVNH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.