* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VRT752271 |
| CAS: | 869886-67-9 |
| English Synonyms: | VRT752271 |
| MDL Number.: | MFCD22543853 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | CC(C)Nc1cc(c(cn1)Cl)c2cc([nH]c2)C(=O)N[C@H](CO)c3cccc(c3)Cl.Cl |
| InChi: | InChI=1S/C21H22Cl2N4O2.ClH/c1-12(2)26-20-8-16(17(23)10-25-20)14-7-18(24-9-14)21(29)27-19(11-28)13-4-3-5-15(22)6-13;/h3-10,12,19,24,28H,11H2,1-2H3,(H,25,26)(H,27,29);1H/t19-;/m1./s1 |
| InChiKey: | InChIKey=DKGYQCPFBWFTHM-FSRHSHDFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.