* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINOLINE, 1,2,3,4-TETRAHYDRO-8-METHYL-7-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)- |
English Synonyms: | QUINOLINE, 1,2,3,4-TETRAHYDRO-8-METHYL-7-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)- |
MDL Number.: | MFCD22572068 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc3c(c2C)NCCC3 |
InChi: | InChI=1S/C16H24BNO2/c1-11-13(9-8-12-7-6-10-18-14(11)12)17-19-15(2,3)16(4,5)20-17/h8-9,18H,6-7,10H2,1-5H3 |
InChiKey: | InChIKey=KXZDUAOWALSLMB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.