* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JNJ39393406 |
English Synonyms: | JNJ39393406 |
MDL Number.: | MFCD22572361 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | CN(C)C(=O)CCn1c(nc(n1)Nc2ccc3c(c2)OC(O3)(F)F)c4ccncc4 |
InChi: | InChI=1S/C19H18F2N6O3/c1-26(2)16(28)7-10-27-17(12-5-8-22-9-6-12)24-18(25-27)23-13-3-4-14-15(11-13)30-19(20,21)29-14/h3-6,8-9,11H,7,10H2,1-2H3,(H,23,25) |
InChiKey: | InChIKey=IURMHZBQEYNQOH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.