* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JNJ-40782755 |
| English Synonyms: | JNJ-40782755 |
| MDL Number.: | MFCD22572362 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1cc(c(c(c1)Cl)C(=O)NCCN2CCC3(CC2)NC(=O)c4ccc(c(c4O3)Cl)N)Cl |
| InChi: | InChI=1S/C21H21Cl3N4O3/c22-13-2-1-3-14(23)16(13)20(30)26-8-11-28-9-6-21(7-10-28)27-19(29)12-4-5-15(25)17(24)18(12)31-21/h1-5H,6-11,25H2,(H,26,30)(H,27,29) |
| InChiKey: | InChIKey=NVDYZTAOHFKSOH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.