* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JNJ40411813 |
English Synonyms: | JNJ40411813 |
MDL Number.: | MFCD22572363 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCCCn1ccc(c(c1=O)Cl)N2CCC(CC2)c3ccccc3 |
InChi: | InChI=1S/C20H25ClN2O/c1-2-3-12-23-15-11-18(19(21)20(23)24)22-13-9-17(10-14-22)16-7-5-4-6-8-16/h4-8,11,15,17H,2-3,9-10,12-14H2,1H3 |
InChiKey: | InChIKey=HYOGJHCDLQSAHX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.