* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-NONANAL |
| CAS: | 3085-26-5 |
| English Synonyms: | 8-METHYL-NONANAL ; NONANAL, 8-METHYL- |
| MDL Number.: | MFCD22581580 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(C)CCCCCCC=O |
| InChi: | InChI=1S/C10H20O/c1-10(2)8-6-4-3-5-7-9-11/h9-10H,3-8H2,1-2H3 |
| InChiKey: | InChIKey=WDMOXLRWVGEXJV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.