* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JNJ-38120836 |
CAS: | 1028048-68-1 |
English Synonyms: | JNJ-38120836 |
MDL Number.: | MFCD22665708 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CSc1c2ccccc2c(s1)C(=O)N3CCC4(CC3)COc5c4cc(cc5)CN |
InChi: | InChI=1S/C23H24N2O2S2/c1-28-22-17-5-3-2-4-16(17)20(29-22)21(26)25-10-8-23(9-11-25)14-27-19-7-6-15(13-24)12-18(19)23/h2-7,12H,8-11,13-14,24H2,1H3 |
InChiKey: | InChIKey=VCUDZTCDUDDJGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.