Molecular Structure:
CCD No.:CCD07564155
Y 11
CAS No.:
1086639-59-9
Formula:C8 H17 N4 O . Br
MolWeight:265.153
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | Y 11 |
| CAS： | 1086639-59-9 |
| English Synonyms： | Y 11 |
| MDL Number.： | MFCD22683838 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | C1N2CN3CN1C[N+](C2)(C3)CCO.[Br-] |
| InChi： | InChI=1S/C8H17N4O.BrH/c13-2-1-12-6-9-3-10(7-12)5-11(4-9)8-12;/h13H,1-8H2;1H/q+1;/p-1 |
| InChiKey： | InChIKey=HBPXFHNNLMCUPA-UHFFFAOYSA-M |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
