* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | GSK J1 |
CAS: | 1373422-53-7 |
English Synonyms: | GSK J1 |
MDL Number.: | MFCD22683851 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)CCN(CC2)c3cc(nc(n3)c4ccccn4)NCCC(=O)O |
InChi: | InChI=1S/C22H23N5O2/c28-21(29)8-12-24-19-15-20(26-22(25-19)18-7-3-4-11-23-18)27-13-9-16-5-1-2-6-17(16)10-14-27/h1-7,11,15H,8-10,12-14H2,(H,28,29)(H,24,25,26) |
InChiKey: | InChIKey=AVZCPICCWKMZDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.