* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOLIN-5-YL(1H-1,2,3-TRIAZOL-4-YL)METHANOL |
| English Synonyms: | QUINOLIN-5-YL(1H-1,2,3-TRIAZOL-4-YL)METHANOL |
| MDL Number.: | MFCD23073925 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1cc(c2cccnc2c1)C(c3c[nH]nn3)O |
| InChi: | InChI=1S/C12H10N4O/c17-12(11-7-14-16-15-11)9-3-1-5-10-8(9)4-2-6-13-10/h1-7,12,17H,(H,14,15,16) |
| InChiKey: | InChIKey=DUCWYXBIVMDMNS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.