* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOLIN-8-YL(4H-1,2,4-TRIAZOL-3-YL)METHANAMINE |
| English Synonyms: | QUINOLIN-8-YL(4H-1,2,4-TRIAZOL-3-YL)METHANAMINE |
| MDL Number.: | MFCD23074104 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1cc2cccnc2c(c1)C(c3[nH]cnn3)N |
| InChi: | InChI=1S/C12H11N5/c13-10(12-15-7-16-17-12)9-5-1-3-8-4-2-6-14-11(8)9/h1-7,10H,13H2,(H,15,16,17) |
| InChiKey: | InChIKey=GEHQCCCZMRBFMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.