* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOLINE-5,7,8-TRIOL |
| English Synonyms: | QUINOLINE-5,7,8-TRIOL |
| MDL Number.: | MFCD23111292 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1cc2c(cc(c(c2nc1)O)O)O |
| InChi: | InChI=1S/C9H7NO3/c11-6-4-7(12)9(13)8-5(6)2-1-3-10-8/h1-4,11-13H |
| InChiKey: | InChIKey=MUIWRMREWWNAND-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.