* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Q196 4,5-DINITRO-9,10-PHENANTHRENEQUINONE |
| CAS: | 32060-66-5 |
| English Synonyms: | Q196 4,5-DINITRO-9,10-PHENANTHRENEQUINONE |
| MDL Number.: | MFCD00019101 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | c1cc2c(c(c1)[N+](=O)[O-])-c3c(cccc3[N+](=O)[O-])C(=O)C2=O |
| InChi: | InChI=1S/C14H6N2O6/c17-13-7-3-1-5-9(15(19)20)11(7)12-8(14(13)18)4-2-6-10(12)16(21)22/h1-6H |
| InChiKey: | InChIKey=MKNHPRWGHGSYFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.