* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Q 53 2-ACETOXY-3-ISOBUTYL-1,4-NAPHTHOQUINONE |
| CAS: | 144538-04-5 |
| English Synonyms: | Q 53 2-ACETOXY-3-ISOBUTYL-1,4-NAPHTHOQUINONE |
| MDL Number.: | MFCD00019533 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC(C)CC1=C(C(=O)c2ccccc2C1=O)OC(=O)C |
| InChi: | InChI=1S/C16H16O4/c1-9(2)8-13-14(18)11-6-4-5-7-12(11)15(19)16(13)20-10(3)17/h4-7,9H,8H2,1-3H3 |
| InChiKey: | InChIKey=SVQGABAJPMGSFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.