* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Q136 2-(2,3-DIMETHYLBUTYL)-3-HYDROXY-1,4-NAPHTHOQUINONE |
| English Synonyms: | Q136 2-(2,3-DIMETHYLBUTYL)-3-HYDROXY-1,4-NAPHTHOQUINONE |
| MDL Number.: | MFCD00019576 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)C(C)CC1=C(C(=O)c2ccccc2C1=O)O |
| InChi: | InChI=1S/C16H18O3/c1-9(2)10(3)8-13-14(17)11-6-4-5-7-12(11)15(18)16(13)19/h4-7,9-10,19H,8H2,1-3H3 |
| InChiKey: | InChIKey=MNTFGPTUJSZCLY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.