* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Q148 2-(8-CARBOXYOCTYL)-1,4-NAPHTHOQUINONE |
| English Synonyms: | Q148 2-(8-CARBOXYOCTYL)-1,4-NAPHTHOQUINONE |
| MDL Number.: | MFCD00019653 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)C(=O)C=C(C2=O)CCCCCCCCC(=O)O |
| InChi: | InChI=1S/C19H22O4/c20-17-13-14(19(23)16-11-8-7-10-15(16)17)9-5-3-1-2-4-6-12-18(21)22/h7-8,10-11,13H,1-6,9,12H2,(H,21,22) |
| InChiKey: | InChIKey=ZBFIKFRTUMZSHA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.