* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Q218 4-BUTOXY-1,2-NAPHTHOQUINONE |
CAS: | 107909-31-9 |
English Synonyms: | Q218 4-BUTOXY-1,2-NAPHTHOQUINONE |
MDL Number.: | MFCD00019670 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCCCOC1=CC(=O)C(=O)c2c1cccc2 |
InChi: | InChI=1S/C14H14O3/c1-2-3-8-17-13-9-12(15)14(16)11-7-5-4-6-10(11)13/h4-7,9H,2-3,8H2,1H3 |
InChiKey: | InChIKey=SMJAIQXDGOKGBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.