* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Q 22 2,3-DIHYDRO-2-(1-METHYLETHENYL)NAPHTHO(1,2-B)FURAN-4,5-DIONE |
| CAS: | 74693-31-5 |
| English Synonyms: | Q 22 2,3-DIHYDRO-2-(1-METHYLETHENYL)NAPHTHO(1,2-B)FURAN-4,5-DIONE |
| MDL Number.: | MFCD00022189 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC(=C)C1CC2=C(O1)c3ccccc3C(=O)C2=O |
| InChi: | InChI=1S/C15H12O3/c1-8(2)12-7-11-14(17)13(16)9-5-3-4-6-10(9)15(11)18-12/h3-6,12H,1,7H2,2H3 |
| InChiKey: | InChIKey=JXIGNVDGTOKIJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.