* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JAK2 INHIBITOR V, Z3 |
| CAS: | 195371-52-9 |
| English Synonyms: | 1-BUTANONE, 2-METHYL-1-PHENYL-4-(2-PYRIDINYL)-2-[2-(2-PYRIDINYL)ETHYL]- ; JAK2 INHIBITOR V, Z3 |
| MDL Number.: | MFCD00023550 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC(CCc1ccccn1)(CCc2ccccn2)C(=O)c3ccccc3 |
| InChi: | InChI=1S/C23H24N2O/c1-23(15-13-20-11-5-7-17-24-20,16-14-21-12-6-8-18-25-21)22(26)19-9-3-2-4-10-19/h2-12,17-18H,13-16H2,1H3 |
| InChiKey: | InChIKey=SETYDCSRABYHSW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.