* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Q 44 2-(3-(3-CYCLOHEXEN-1-YL)PROPYL)-3-HYDROXY-1,4-NAPHTHOQUINONE |
| CAS: | 19477-39-5 |
| English Synonyms: | Q 44 2-(3-(3-CYCLOHEXEN-1-YL)PROPYL)-3-HYDROXY-1,4-NAPHTHOQUINONE |
| MDL Number.: | MFCD00029219 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)C(=O)C(=C(C2=O)O)CCCC3CCC=CC3 |
| InChi: | InChI=1S/C19H20O3/c20-17-14-10-4-5-11-15(14)18(21)19(22)16(17)12-6-9-13-7-2-1-3-8-13/h1-2,4-5,10-11,13,22H,3,6-9,12H2 |
| InChiKey: | InChIKey=OUZGKDMYPJCZEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.