* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOLINE PICRATE |
| English Synonyms: | QUINOLINE PICRATE |
| MDL Number.: | MFCD00136997 |
| H bond acceptor: | 10 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)cccn2.c1c(cc(c(c1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-] |
| InChi: | InChI=1S/C9H7N.C6H3N3O7/c1-2-6-9-8(4-1)5-3-7-10-9;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-7H;1-2,10H |
| InChiKey: | InChIKey=IUHDXLHMQOVWQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.