* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-PYRIDINOL, 4,6-DIAMINO- |
| CAS: | 89179-68-0 |
| English Synonyms: | 2-PYRIDINOL, 4,6-DIAMINO- ; 4,6-DIAMINO-2-PYRIDINOL ; 4,6-DIAMINOPYRIDIN-2-OL |
| MDL Number.: | MFCD00209840 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1c(cc(nc1N)O)N |
| InChi: | InChI=1S/C5H7N3O/c6-3-1-4(7)8-5(9)2-3/h1-2H,(H5,6,7,8,9) |
| InChiKey: | InChIKey=CZJVKGYLLHCLIR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.