* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BICYCLO(2.2.2)OCTANE-1,4-DIOL |
CAS: | 1194-44-1 |
English Synonyms: | BICYCLO(2.2.2)OCTANE-1,4-DIOL |
MDL Number.: | MFCD00213487 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1C[C@@]2(CC[C@]1(CC2)O)O |
InChi: | InChI=1S/C8H14O2/c9-7-1-2-8(10,5-3-7)6-4-7/h9-10H,1-6H2/t7-,8+ |
InChiKey: | InChIKey=BHSZKPHKWKSMKX-OCAPTIKFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.