* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-DODECYNOIC ACID |
| CAS: | 18545-07-8 |
| English Synonyms: | DODEC-8-YNOIC ACID ; 8-DODECYNOIC ACID |
| MDL Number.: | MFCD00464357 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCC#CCCCCCCC(=O)O |
| InChi: | InChI=1S/C12H20O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-3,6-11H2,1H3,(H,13,14) |
| InChiKey: | InChIKey=SGUNFKQJWPYUMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.