* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOLIN-6-YL ACETATE |
| CAS: | 24306-33-0 |
| English Synonyms: | QUINOLIN-6-YL ACETATE |
| MDL Number.: | MFCD00466075 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC(=O)Oc1ccc2c(c1)cccn2 |
| InChi: | InChI=1S/C11H9NO2/c1-8(13)14-10-4-5-11-9(7-10)3-2-6-12-11/h2-7H,1H3 |
| InChiKey: | InChIKey=BHXCPQHXDLLGAV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.