* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8,10-DIMETHYL-2,4,5,8,10-PENTAZABICYCLO[4.4.0]DECA-1,5-DIENE-3,7,9-TRIONE |
| CAS: | 7271-90-1 |
| English Synonyms: | 8,10-DIMETHYL-2,4,5,8,10-PENTAZABICYCLO[4.4.0]DECA-1,5-DIENE-3,7,9-TRIONE |
| MDL Number.: | MFCD00493945 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | Cn1c2c(c(=O)n(c1=O)C)n[nH]c(=O)n2 |
| InChi: | InChI=1S/C7H7N5O3/c1-11-4-3(9-10-6(14)8-4)5(13)12(2)7(11)15/h1-2H3,(H,8,10,14) |
| InChiKey: | InChIKey=MMOSHKRLQYNTDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.