* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-DIBENZ[B,F][1,4]OXAZEPINE |
| CAS: | 55113-22-9 |
| English Synonyms: | DIBENZ[B,F][1,4]OXAZEPINE, 8-METHYL- ; 8-METHYL-DIBENZ[B,F][1,4]OXAZEPINE |
| MDL Number.: | MFCD00506685 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | Cc1ccc2c(c1)N=Cc3ccccc3O2 |
| InChi: | InChI=1S/C14H11NO/c1-10-6-7-14-12(8-10)15-9-11-4-2-3-5-13(11)16-14/h2-9H,1H3 |
| InChiKey: | InChIKey=KQLZLXUHKFVMTF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.