* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB BBL009639 |
| English Synonyms: | VITAS-BB BBL009639 |
| MDL Number.: | MFCD00546610 |
| H bond acceptor: | 12 |
| H bond donor: | 1 |
| Smile: | CC(=O)OCC1C(C(C(O1)n2cnc3c2nc[nH]c3=O)OC(=O)C)OC(=O)C |
| InChi: | InChI=1S/C16H18N4O8/c1-7(21)25-4-10-12(26-8(2)22)13(27-9(3)23)16(28-10)20-6-19-11-14(20)17-5-18-15(11)24/h5-6,10,12-13,16H,4H2,1-3H3,(H,17,18,24) |
| InChiKey: | InChIKey=SFEQTFDQPJQUJM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.