* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-CF012912 |
| English Synonyms: | CHOLAN-24-OIC ACID, 3,7-DIHYDROXY-, (3A,5B,7B)- ; ZERENEX ZX-CF012912 |
| MDL Number.: | MFCD00599603 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C |
| InChi: | InChI=1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-/m1/s1 |
| InChiKey: | InChIKey=RUDATBOHQWOJDD-UZVSRGJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.