* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(N'-(1-(4-CL-PH)-ETHYLIDENE)-HYDRAZINO)-7-ET-3-ME-3,7-DIHYDRO-PURINE-2,6-DIONE |
| English Synonyms: | 8-(N'-(1-(4-CL-PH)-ETHYLIDENE)-HYDRAZINO)-7-ET-3-ME-3,7-DIHYDRO-PURINE-2,6-DIONE |
| MDL Number.: | MFCD00612298 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCn1c2c(=O)[nH]c(=O)n(c2nc1N/N=C(\C)/c3ccc(cc3)Cl)C |
| InChi: | InChI=1S/C16H17ClN6O2/c1-4-23-12-13(22(3)16(25)19-14(12)24)18-15(23)21-20-9(2)10-5-7-11(17)8-6-10/h5-8H,4H2,1-3H3,(H,18,21)(H,19,24,25)/b20-9+ |
| InChiKey: | InChIKey=VJGHIAYSMFBZAP-AWQFTUOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.