* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8,8'-THIOBIS(3-METHYL-7-OCTYL-1H-PURINE-2,6(3H,7H)-DIONE) |
| English Synonyms: | 8,8'-THIOBIS(3-METHYL-7-OCTYL-1H-PURINE-2,6(3H,7H)-DIONE) |
| MDL Number.: | MFCD00612621 |
| H bond acceptor: | 12 |
| H bond donor: | 2 |
| Smile: | CCCCCCCCn1c2c(=O)[nH]c(=O)n(c2nc1Sc3nc4c(n3CCCCCCCC)c(=O)[nH]c(=O)n4C)C |
| InChi: | InChI=1S/C28H42N8O4S/c1-5-7-9-11-13-15-17-35-19-21(33(3)25(39)31-23(19)37)29-27(35)41-28-30-22-20(24(38)32-26(40)34(22)4)36(28)18-16-14-12-10-8-6-2/h5-18H2,1-4H3,(H,31,37,39)(H,32,38,40) |
| InChiKey: | InChIKey=HYGOEPRMVNZUFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.