* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(N'-(1-(4-BR-PH)-ETHYLIDENE)-HYDRAZINO)-3-ME-7-NONYL-3,7-2H-PURINE-2,6-DIONE |
| English Synonyms: | 8-(N'-(1-(4-BR-PH)-ETHYLIDENE)-HYDRAZINO)-3-ME-7-NONYL-3,7-2H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD00620784 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCCCCCCCCn1c2c(=O)[nH]c(=O)n(c2nc1N/N=C(/C)\c3ccc(cc3)Br)C |
| InChi: | InChI=1S/C23H31BrN6O2/c1-4-5-6-7-8-9-10-15-30-19-20(29(3)23(32)26-21(19)31)25-22(30)28-27-16(2)17-11-13-18(24)14-12-17/h11-14H,4-10,15H2,1-3H3,(H,25,28)(H,26,31,32)/b27-16- |
| InChiKey: | InChIKey=VBRVNAIGMXVDES-YUMHPJSZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.