* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(BENZYLAMINO)-3,7-DIMETHYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| English Synonyms: | 8-(BENZYLAMINO)-3,7-DIMETHYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD00630756 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cn1c2c(=O)[nH]c(=O)n(c2nc1NCc3ccccc3)C |
| InChi: | InChI=1S/C14H15N5O2/c1-18-10-11(19(2)14(21)17-12(10)20)16-13(18)15-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,15,16)(H,17,20,21) |
| InChiKey: | InChIKey=SGUHCAOVLSRBEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.