* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-1,3-DIMETHYL-7-(3-METHYL-BUTYL)-3,7-DIHYDRO-PURINE-2,6-DIONE |
| English Synonyms: | 8-BROMO-1,3-DIMETHYL-7-(3-METHYL-BUTYL)-3,7-DIHYDRO-PURINE-2,6-DIONE |
| MDL Number.: | MFCD00653131 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC(C)CCn1c2c(nc1Br)n(c(=O)n(c2=O)C)C |
| InChi: | InChI=1S/C12H17BrN4O2/c1-7(2)5-6-17-8-9(14-11(17)13)15(3)12(19)16(4)10(8)18/h7H,5-6H2,1-4H3 |
| InChiKey: | InChIKey=GCZUXBDBZLRLTK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.