* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8,19-EPOXY-3-BETA,5-DI-HO-20-OXO-5-PREGNANE-19,21-DIYL-21-ACETATE 19-ME ETHER |
| English Synonyms: | 8,19-EPOXY-3-BETA,5-DI-HO-20-OXO-5-PREGNANE-19,21-DIYL-21-ACETATE 19-ME ETHER |
| MDL Number.: | MFCD00670721 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(=O)OCC(=O)[C@@H]1CCC2C1(CCC3[C@@]24CCC5([C@]3(CCC(C5)O)C(O4)OC)O)C |
| InChi: | InChI=1S/C24H36O7/c1-14(25)30-13-17(27)16-4-5-18-21(16,2)8-7-19-23-9-6-15(26)12-22(23,28)10-11-24(18,19)31-20(23)29-3/h15-16,18-20,26,28H,4-13H2,1-3H3/t15?,16-,18?,19?,20?,21?,22?,23-,24+/m0/s1 |
| InChiKey: | InChIKey=KFAYSMNHDRTHBG-ZXFANFNSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.