* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYCINE, N-(2,3-DIHYDRO-3-OXO-1,2,4-TRIAZIN-5-YL)- |
CAS: | 221663-54-3 |
English Synonyms: | N-(2,3-DIHYDRO-3-OXO-1,2,4-TRIAZIN-5-YL)-GLYCINE ; 2-[(3-OXO-2,3-DIHYDRO-1,2,4-TRIAZIN-5-YL)AMINO]ACETIC ACID ; GLYCINE, N-(2,3-DIHYDRO-3-OXO-1,2,4-TRIAZIN-5-YL)- |
MDL Number.: | MFCD00702831 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1c(nc(=O)[nH]n1)NCC(=O)O |
InChi: | InChI=1S/C5H6N4O3/c10-4(11)2-6-3-1-7-9-5(12)8-3/h1H,2H2,(H,10,11)(H2,6,8,9,12) |
InChiKey: | InChIKey=KLXZNCLOZYCHRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.