* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GENTAMICIN C2 |
CAS: | 25876-11-3 |
English Synonyms: | GENTAMICIN C2 |
MDL Number.: | MFCD00869297 |
H bond acceptor: | 12 |
H bond donor: | 8 |
Smile: | CC([C@@H]1CC[C@H]([C@H](O1)O[C@@H]2[C@H](C[C@H]([C@@H]([C@H]2O)O[C@H]3[C@H]([C@@H]([C@](CO3)(C)O)NC)O)N)N)N)N |
InChi: | InChI=1S/C20H41N5O7/c1-8(21)12-5-4-9(22)18(30-12)31-15-10(23)6-11(24)16(13(15)26)32-19-14(27)17(25-3)20(2,28)7-29-19/h8-19,25-28H,4-7,21-24H2,1-3H3/t8?,9-,10+,11-,12+,13+,14+,15-,16+,17+,18-,19+,20-/m1/s1 |
InChiKey: | InChIKey=XUFIWSHGXVLULG-OTYHCWHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.