* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ICI-164384 |
| CAS: | 98007-99-9 |
| English Synonyms: | ICI-164384 |
| MDL Number.: | MFCD00875699 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCCN(C)C(=O)CCCCCCCCCC[C@@H]1Cc2cc(ccc2[C@@H]3[C@@H]1[C@@H]4CC[C@@H]([C@]4(CC3)C)O)O |
| InChi: | InChI=1S/C34H55NO3/c1-4-5-22-35(3)32(38)15-13-11-9-7-6-8-10-12-14-25-23-26-24-27(36)16-17-28(26)29-20-21-34(2)30(33(25)29)18-19-31(34)37/h16-17,24-25,29-31,33,36-37H,4-15,18-23H2,1-3H3/t25-,29-,30+,31+,33-,34+/m1/s1 |
| InChiKey: | InChIKey=BVVFOLSZMQVDKV-KXQIQQEYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.