* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | YM 750 |
CAS: | 138046-43-2 |
English Synonyms: | YM 750 |
MDL Number.: | MFCD00905424 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cc(c(c(c1)C)NC(=O)N(Cc2ccc-3c(c2)Cc4c3cccc4)C5CCCCCC5)C |
InChi: | InChI=1S/C31H36N2O/c1-21-16-22(2)30(23(3)17-21)32-31(34)33(27-11-6-4-5-7-12-27)20-24-14-15-29-26(18-24)19-25-10-8-9-13-28(25)29/h8-10,13-18,27H,4-7,11-12,19-20H2,1-3H3,(H,32,34) |
InChiKey: | InChIKey=FMLJREWZCZHGGW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.