* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Y 29794 |
CAS: | 129184-48-1 |
English Synonyms: | Y 29794 |
MDL Number.: | MFCD00908197 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(C)c1ccc(c(n1)SCCCCCCCCN(C)C)C(=O)c2cccs2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
InChi: | InChI=1S/C23H34N2OS2.C6H8O7/c1-18(2)20-14-13-19(22(26)21-12-11-17-27-21)23(24-20)28-16-10-8-6-5-7-9-15-25(3)4;7-3(8)1-6(13,5(11)12)2-4(9)10/h11-14,17-18H,5-10,15-16H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
InChiKey: | InChIKey=RVQHXDCRCXSYNG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.