* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KT-6006 |
| CAS: | 118736-03-1 |
| English Synonyms: | KT-6006 |
| MDL Number.: | MFCD00916497 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | CC12C(CC(O1)n3c4ccc(cc4c5c3c6n2c7ccc(cc7c6c8c5C(=O)NC8)O)O)(C(=O)OC)O |
| InChi: | InChI=1S/C27H21N3O7/c1-26-27(35,25(34)36-2)9-18(37-26)29-16-5-3-11(31)7-13(16)20-21-15(10-28-24(21)33)19-14-8-12(32)4-6-17(14)30(26)23(19)22(20)29/h3-8,18,31-32,35H,9-10H2,1-2H3,(H,28,33) |
| InChiKey: | InChIKey=AHHRZZZJSYPMNM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.