* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KT-6528 |
| CAS: | 145308-04-9 |
| English Synonyms: | KT-6528 |
| MDL Number.: | MFCD00916498 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | CC12C(CC(O1)n3c4ccccc4c5c3c6n2c7ccccc7c6c8c5C(=O)N(C8=O)O)(CO)O |
| InChi: | InChI=1S/C26H19N3O6/c1-25-26(33,11-30)10-16(35-25)27-14-8-4-2-6-12(14)17-19-20(24(32)29(34)23(19)31)18-13-7-3-5-9-15(13)28(25)22(18)21(17)27/h2-9,16,30,33-34H,10-11H2,1H3 |
| InChiKey: | InChIKey=KNJUOEDHHOTPLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.