* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JTP 4819 |
| CAS: | 162203-65-8 |
| English Synonyms: | JTP 4819 |
| MDL Number.: | MFCD00931195 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)CNC(=O)N2CCC[C@H]2C(=O)N3CCC[C@H]3C(=O)CO |
| InChi: | InChI=1S/C19H25N3O4/c23-13-17(24)15-8-4-10-21(15)18(25)16-9-5-11-22(16)19(26)20-12-14-6-2-1-3-7-14/h1-3,6-7,15-16,23H,4-5,8-13H2,(H,20,26)/t15-,16-/m0/s1 |
| InChiKey: | InChIKey=ICULFJDHZQTNRB-HOTGVXAUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.