* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | W4R |
English Synonyms: | W4R |
MDL Number.: | MFCD00932317 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCN(CC)CCn1c2cc(cc(c2c(=O)c3c1cc(c(c3)N)Cl)O)OC |
InChi: | InChI=1S/C20H24ClN3O3/c1-4-23(5-2)6-7-24-16-11-14(21)15(22)10-13(16)20(26)19-17(24)8-12(27-3)9-18(19)25/h8-11,25H,4-7,22H2,1-3H3 |
InChiKey: | InChIKey=RJQIVCHKGLXNOW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.